giuliapena08888 giuliapena08888

23-06-2021
Chemistry

contestada

31. Adding an additional oxygen atom to 02 creates....
ozone
oxygen
methane
CFC

PLEASE HELP

Respuesta :

dhuidbehehs dhuidbehehs

23-06-2021

It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs

Answer Link

Otras preguntas

Read the dictionary entry. compassionate \kǝm- pa-sh(ǝ-)nǝt adjective 1. showing sympathy 2. provided because of unusual painful circumstances for an individu

If you have an isotope of the element carbon (C) that has the mass number of 14, what other information would help you determine the number of neutrons? A)atomi

The Supreme Court in Georgia consists of judges, who are led by a chief justice.

How did the Mesopotamians transport their goods to and from trade centers?

Convert.835 pounds= ounces

What was the 'headright system'?A. paid passage to the AmericasB. fifty acres of land in return for bringing a servant over to the English coloniesC. All indent

was the new deal an effective response to the Great Depression

this is what causes acceleration when two forces are acting opposite from each other

A company that is authorized y the commissioner to transact insurance business in Louisiana is called a

Why would ethyl alcohol not be a good solvent to use with water in an extraction