samanthalayton22
samanthalayton22 samanthalayton22
  • 21-10-2022
  • Physics
contestada

HSCI 3.6 Mechanical Advantage Quiz
A 60 kg box is lifted into the air. A worker is pulling it up with a force of 100 N. What is the mechanical advantage of the machine?
O 0.17
O 1.66
O 0.6
O 5.9

Respuesta :

Otras preguntas

Find the volume occupied by 26.0 g of helium gas at 28.0 ∘C and 1.30 atm of pressure. 11.5 L 209 L 46.0 L 124 L
help please with this
what is 2x^2-2x-1? add and subtract where needed
A particle of mass 0.2 kg moves along a path given by the relation : → ∧ ∧r = 2 cos ωti + 3 sin ωtj. Then the torque on the particle about the origin is : ∧A.
Are there any ways to determine how wide you want the band for your background to be ________.
cos(x+pi/6)-cos(x-pi/6)=1How do I solve this by using the sum and difference formulas?​
Why does a grill converts to a chemical energy
A cube has a side length of 8 centimeters. The surface area of a cube is 6 times the square of a side length.
Bill _____ removes the reverse onus previously placed on employers to justify their classification of workers as independent contractors? 1) Law 2) Legislation
In 1962, for what did Britain and France sign an agreement to build together?